Etomidate HCl
Etomidate HCl is a GABAA receptors agonist, which is a short acting intravenous anaesthetic agent used for the induction of general anaesthesia.
| Trivial name | R16659 HCl |
| Catalog Number | CSN18321 |
| Alternative Name(s) | R16659 HCl |
| Research Area | Neurological Disease |
| Molecular Formula | C14H17ClN2O2 |
| CAS# | 53188-20-8 |
| Purity | ≥98% |
| SMILES | O=C(C1=CN=CN1[C@@H](C2=CC=CC=C2)C)OCC.Cl |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/etomidate-hcl.html |