Pirfenidone
Pirfenidone is an inhibitor for TGF-β production and TGF-β stimulated collagen production, reduces production of TNF-α and IL-1β, and also has anti-fibrotic and anti-inflammatory properties.
| Trivial name | S7701; AMR-69 |
| Catalog Number | CSN13806 |
| Alternative Name(s) | S7701; AMR-69 |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C12H11NO |
| CAS# | 53179-13-8 |
| Purity | ≥99% |
| SMILES | C1=CC=CC=C1N2C(C=CC(=C2)C)=O |
| Size | 5g |
| Supplier Page | https://www.csnpharm.com/products/pirfenidone.html |
