Equol
non-steroidal estrogen Endocrinology and Hormones|Estrogen/progestogen Receptor
| Catalog Number | B1514-5 |
| Research Area | Endocrinology and Hormones|Estrogen/progestogen Receptor |
| Molecular Formula | C15H14O3 |
| CAS# | 531-95-3 |
| Purity | 99.23% |
| SMILES | C1C(COC2=C1C=CC(=C2)O)C3=CC=C(C=C3)O |
| Size | 5mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1514 |
