7-Methoxycoumarin
7-Methoxycoumarin, a natural product isolated and purified from the herbs of Citrus reticulata cv. Chachiensis, has potent antioxidant effect, strong hepatoprotective activity, and weak estrogenic activity.
| Trivial name | 7-Methoxy-2H-Chromen-2-One |
| Catalog Number | CSN10943 |
| Alternative Name(s) | 7-Methoxy-2H-Chromen-2-One |
| Research Area | / |
| Molecular Formula | C10H8O3 |
| CAS# | 531-59-9 |
| Purity | ≥99% |
| SMILES | O=C1C=CC2=C(O1)C=C(OC)C=C2 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/7-methoxycoumarin.html |
