Azure B
Azure B is a cationic dye and the major metabolite of Methylene blue. Azure B is a selective, and reversible inhibitor of MAO-A (IC50s: 11 and 968 nM for recombinant human MAO-A and MAO-B).
| Catalog Number | T18918 |
| Alternative Name(s) | Azure B chloride , 天青 B |
| Research Area | Metabolism|||Neuroscience |
| Molecular Formula | C15H16ClN3S |
| CAS# | 531-55-5 |
| SMILES | CNC1=CC2=[S+]C3=C(C=CC(N(C)C)=C3)N=C2C=C1.[Cl-] |
| Size | 5 mg |
| Supplier Page | https://www.targetmol.com/compound/Azure B |
| Additional Information | https://www.targetmol.com/datasheet/T18918 |