Tert-butanol D10
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-O-11464 |
| Alternative Name(s) | tert-Butyl-ol-d, 2-(methyl-d3);2-Methyl-2-propanol-d10. |
| Research Area | Labeled Tert-butanol intended for use as an internal standard for the quantification of Tert-butanol by GC- or LC-mass spectrometry |
| Molecular Formula | C4D10O |
| CAS# | 53001-22-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])(O[2H])C([2H])([2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11464.html |
| Additional Information | NULL |