1,1′-Carbonyldiimidazole(CDI)
CDI is mainly employed to convert alcohols and amines into carbamates, esters, and ureas. It is also used in the synthesis of peptides and nucleoside triphosphates.
| Catalog Number | INT530621 |
| Alternative Name(s) | 1,1'-Carbonyldiimidazole N,N'-Carbonyldiimidazole di(1H-imidazol-1-yl)methanone N,N-Carbonyldiimidazole |
| Research Area | Intermediates |
| Molecular Formula | C7H6N4O |
| CAS# | 530-62-1 |
| SMILES | C1=CN(C=N1)C(=O)N2C=CN=C2 |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/11-carbonyldiimidazolecdi-item-9221.html |