Indomethacin D7
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-03251 |
| Alternative Name(s) | NULL |
| Research Area | Labeled Indomethacin, intended for use as an internal standard for the quantification of Indomethacin by GC- or LC-mass spectrometry. |
| Molecular Formula | C19H9DClNO4 |
| CAS# | 53-86-1 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(C(C([2H])=C1[2H])=C(C([2H])=C1Cl)[2H])N2C(C([2H])=C([2H])C(OC)=C3[2H])=C3C(CC(O)=O)=C2C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03251.html |
| Additional Information | NULL |