Cortisone D8
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-10250 |
| Alternative Name(s) | 17,21-Dihydroxy-pregn-4-ene-3,11,20-trione-d8; 17-Hydroxy-11-dehydrocorticosterone-d8; 11-Dehydro-17-hydroxy- corticosterone-d8; Adrenalex-d8; Compound E-d8; Cortisate-d8; Cortivite-d8; Cortogen-d8; Cortone-d8; NSC 9703-d8; |
| Research Area | Labeled Cortisone, intended for use as an internal standard for the quantification of Cortisone by GC- or LC-mass spectrometry. Labelled Cortisone Glucocorticoid, anti-inflammatory agent. |
| Molecular Formula | C21H20D8O5 |
| CAS# | 53-06-5 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]1(C2([2H])[2H])[C@](C(CO)=O)(O)CC[C@@]1([H])[C@]3([H])CC([2H])([2H])C4=C([2H])C(C([2H])([2H])C[C@]4(C)[C@@]3([2H])C2=O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO10250.html |
| Additional Information | NULL |