Prednisone
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-31011 |
| Alternative Name(s) | 1,2-Dehya,21-diol-3,11,20-trione;11,20-trione,17,21-dihydroxy-pregna-4-diene-3;11,20-trione,17,21-hydroxy-pregna-4-diene-3e;Colisone;Cortan |
| Research Area | Prednisone is a synthetic glucocorticoid with anti-inflammatory and immunomodulating properties. After cell surface receptor attachment and cell entry, prednisone enters the nucleus where it binds to and activates specific nuclear receptors, resulting in |
| Molecular Formula | C21H26O5 |
| CAS# | 53-03-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@]([C@@]1(O)C(CO)=O)(C2)[C@](CC1)([H])[C@@](CCC3=CC4=O)([H])[C@]([C@]3(C=C4)C)([H])C2=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31011.html |
| Additional Information | NULL |