(±)-1,2-Propanediol-d6 | MedChemExpress (MCE)
(±)-1,2-Propanediol-d6 is the deuterium labeled (±)-1,2-Propanediol[1]. (±)-1,2-Propanediol (1,2-(RS)-Propanediol) is an aliphatic alcohol and frequently used as an excipient in many agent formulations to increase the solubility and stability of agents[2].
| Trivial name | (±)-1,2-Propanediol-d6 |
| Catalog Number | HY-Y0921S2 |
| Alternative Name(s) | 1,2-(RS)-Propanediol-d6; 1,2-Propylene glycol-d6; Propylene glycol-d6 |
| Research Area | Others |
| CAS# | 52910-80-2 |
| Purity | ≥99.00% |
| SMILES | OC([2H])([2H])C(O)([2H])C([2H])([2H])[2H] |
| PubChem Chemical Structure ID | 71309005 |
| Size | 5 mg |
| Supplier Page | https://www.medchemexpress.com/racemic-1-2-propanediol-d6.html |