Scutellarein
Scutellarin is cytotoxic to cancer cells and could induce DNA damage, metabolic suppression and mitochondrial reactive oxygen species. It has has antioxidant, anti-inflammatory, and antiproliferative biological activities that can be can be found in scutellaria lateriflora.
| Trivial name | / |
| Catalog Number | CSN12258 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C15H10O6 |
| CAS# | 529-53-3 |
| Purity | ≥99% |
| SMILES | O=C1C=C(C2=CC=C(O)C=C2)OC3=C1C(O)=C(O)C(O)=C3 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/scutellarein.html |
