(-)-Dalbergiphenol
(-)-Dalbergiphenol is purified from the heartwood of Dalbergia sissoo. It shows antiosteoporotic activity. Dalbergiphenol treatment can effectively prevent OVX-induced increase in bone loss and decrease in bone strength possibly by increasing osteoblastic activities and by decreasing osteoclastic activities.
| Catalog Number | 52811-31-1 |
| Alternative Name(s) | (S)-Dalbergiphenol |
| Molecular Formula | C17H18O3 |
| CAS# | 52811-31-1 |
| Purity | 92% |
| Inchi | InChI=1S/C17H18O3/c1-4-13(12-8-6-5-7-9-12)14-10-15(18)17(20-3)11-16(14)19-2/h4-11,13,18H,1H2,2-3H3/t13-/m0/s1 |
| Inchi Key | SLLCQEPKLKMZKP-ZDUSSCGKSA-N |
| Size | Please inquire |
| Supplier Page | https://www.bocsci.com/dalbergiphenol-cas-52811-31-1-item-267124.html |