Deacetylasperulosidic Acid Methyl Ester
Deacetylasperulosidic acid methyl ester, a natural product isolated and purified from the herbs of Hedyotis diffusa Willd., can lower the blood glucose level in normal mice.
| Trivial name | 6α-Hydroxygeniposide |
| Catalog Number | CSN14334 |
| Alternative Name(s) | 6α-Hydroxygeniposide |
| Research Area | / |
| Molecular Formula | C17H24O11 |
| CAS# | 52613-28-2 |
| Purity | ≥98% |
| SMILES | O=C(C1=CO[C@@H](O[C@H]2[C@@H]([C@H]([C@@H]([C@@H](CO)O2)O)O)O)[C@@]3([H])[C@]1([H])[C@@H](O)C=C3CO)OC |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/deacetylasperulosidic-acid-methyl-ester.html |