Flavone
Flavone (2-Phenylchromone, 2-Phenyl-4-chromone, 2-Phenyl-4-benzopyron), a class of flavonoids, mainly found in spices and red or purple plant foods with antioxidant, anti-proliferative, anti-tumor, anti-microbial, estrogenic, acetyl cholinesterase, anti-inflammatory activities and are also used in cancer, cardiovascular disease, neurodegenerative disorders etc.
| Trivial name | 2-Phenylchromone, 2-Phenyl-4-chromone, 2-Phenyl-4-benzopyron |
| Catalog Number | S3967 |
| Molecular Formula | C82H107N5O20 |
| CAS# | 525-82-6 |
| SMILES | CCC(C1=CC(=C(C(=C1)OC)OC)OC)C(=O)N2CCCCC2C(=O)OC(CCC3=CC(=C(C=C3)OC)OC)C4=CC(=CC=C4)OCC(=O)NCC(CNC(=O)COC5=CC=CC(=C5)C(CCC6=CC(=C(C=C6)OC)OC)OC(=O)C7CCCCN7C(=O)C(CC)C8=CC(=C(C(=C8)OC)OC)OC)CN(C)C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/flavone.html |
| Additional Information | https://file.selleck.cn/downloads/struct/flavone-chemical-structure-s3967.gif |
