Buprenorphine
API Standard
| Catalog Number | CS-O-00994 |
| Alternative Name(s) | (1S,2R,6S,14R,15R,16R)-droxy-3,3-dimethylbutan-2-yl]-15-methoxy-13-oxa-3-azah8.0,6.06,4.07,]icosa-7,9,11-trien-11-ol |
| Research Area | A derivative of the opioid alkaloid THEBAINE that is a more potent and longer lasting analgesic than MORPHINE. It appears to act as a partial agonist at mu and kappa opioid receptors and as an antagonist at delta receptors. The lack of delta-agonist activ |
| Molecular Formula | C29H41NO4 |
| CAS# | 52485-79-7 |
| Purity | >98% |
| SMILES | CO[C@@]1(CC2)[C@@](OC3=C4C5=CC=C3O)([H])[C@@]4(CCN(CC6CC6)[C@]7([H])C5)[C@@]27C[C@]1([H])[C@](C)(O)C(C)(C)C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00994.html |
