Tetrahydrodehydrodiconiferyl alcohol | MedChemExpress (MCE)
Tetrahydrodehydrodiconiferyl alcohol (TDDC) is a reduction product of dihydrodehydrodiconiferyl alcohol catalyzed by phenylcoumaran benzylic ether reductase. Tetrahydrodehydrodiconiferyl alcohol can be isolated from a hydrogenolysis product of protolignin[1].
| Trivial name | Tetrahydrodehydrodiconiferyl alcohol |
| Catalog Number | HY-N9903 |
| Alternative Name(s) | TDDC |
| Research Area | Others |
| CAS# | 5234-70-8 |
| Purity | ≥98.0% |
| SMILES | OC1=CC=C(CC(CO)C2=CC(CCCO)=CC(OC)=C2O)C=C1OC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/tetrahydrodehydrodiconiferyl-alcohol.html |