Karanjin
Karanjin, a natural product isolated and purified from the seeds of the karanja tree (Millettia pinnata or Pongamia glabra Vent.), has an effects on cell cycle arrest and apoptosis in human A549, HepG2 and HL-60 cancer cells.
| Trivial name | / |
| Catalog Number | CSN11248 |
| Alternative Name(s) | / |
| Research Area | Cancer |
| Molecular Formula | C18H12O4 |
| CAS# | 521-88-0 |
| Purity | ≥98% |
| SMILES | O=C1C(OC)=C(C2=CC=CC=C2)OC3=C1C=CC4=C3C=CO4 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/karanjin.html |