Hesperetin
Hesperetin is a flavanone extracted from the peel of citrus that exhibits inhibition of PDE4 and UGT. Hesperetin has antioxidative and anti-inflammatory effects as well. Hesperetin dose-dependently inhibited cleavage activity of the 3CLpro with IC50 value of 8.3μM in the cell-based assay.
| Trivial name | / |
| Catalog Number | CSN16383 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C16H14O6 |
| CAS# | 520-33-2 |
| Purity | ≥98% |
| SMILES | O=C1C[C@H](OC2=C1C(O)=CC(O)=C2)C3=CC=C(C(O)=C3)OC |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/hesperetin.html |