Tectochrysin
Tectochrysin (Techtochrysin, NSC 80687) is one of the major flavonoids of Alpinia oxyphylla Miquel. Tectochrysin significantly increases the expression of DR3, DR4 and Fas and inhibits activity of NF-κB. Tectochrysin induces apoptotic cell death.
| Trivial name | Techtochrysin, NSC 80687 |
| Catalog Number | S3256 |
| Molecular Formula | C16H12O4 |
| CAS# | 520-28-5 |
| SMILES | COC1=CC(=C2C(=O)C=C(OC2=C1)C3=CC=CC=C3)O |
| Size | 1mg |
| Supplier Page | http://www.selleckchem.com/products/tectochrysin.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3256-techtochrysin-chemical-structure.gif |