5-HYDROXY-7-METHOXYFLAVONE
It has a role as a plant metabolite, an antidiarrhoeal drug and an antineoplastic agent. It is a monohydroxyflavone and a monomethoxyflavone. It is functionally related to a flavone.
| Catalog Number | PIPE-0540 |
| Alternative Name(s) | Tectochrysin 5-Hydroxy-7-methoxyflavone 5-Hydroxy-7-methoxy-2-phenyl-4H-chromen-4-one Techtochrysin |
| Research Area | Natural Extract |
| Molecular Formula | C16H12O4 |
| CAS# | 520-28-5 |
| SMILES | COC1=CC(=C2C(=C1)OC(=CC2=O)C3=CC=CC=C3)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/5-hydroxy-7-methoxyflavone-item-9479.html |