Kaempferol 200mg
Kaempferol is found to inhibit bovine aorta myosin light chain kinase with a Ki of 0.3-0.5 microM and also is found to inhibit VEGF expression and in vitro angiogenesis through a novel ERK-NF??B-cMyc-p21 pathway.
| Trivial name | Kaempferol 200mg |
| Catalog Number | A10495-200 |
| Alternative Name(s) | 3,5,7-Trihydroxy-2-(4-hydroxyphenyl)-4H-chromen-4-one |
| Molecular Formula | C15H10O6 |
| CAS# | 520-18-3 |
| SMILES | C1=CC(=CC=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/kaempferol.html |
