L-Cysteine HCl
L-cysteine Hydrochloride, also known as L-CYSTEINE or Cysteine HCL (anhydrous), is classified as a cysteine or a cysteine derivative that increases glutathione levels and is important for lung and brain function and liver detoxification.
| Trivial name | N/A |
| Catalog Number | S4815 |
| Molecular Formula | C3 H7 N O2 S . Cl H |
| CAS# | 52-89-1 |
| Inchi | InChI=1S/C3H7NO2S.ClH/c4-2(1-7)3(5)6;/h2,7H,1,4H2,(H,5,6);1H/t2-;/m0./s1 |
| Inchi Key | IFQSXNOEEPCSLW-DKWTVANSSA-N |
| SMILES | C(C(C(=O)O)N)S.Cl |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/l-cysteine-hcl.html |
| Additional Information | https://file.selleck.cn/downloads/struct/l-cysteine-hcl-chemical-structure-S4815.gif |