Aldosterone
API Standard
| Catalog Number | CS-O-30494 |
| Alternative Name(s) | (11β)-11,21-Dihydroxy-3,20-dioxopregn-4-en-18-al; 11β,21-Dihydroxypregn-4-ene-3,18,20-trione; 18-Formyl-11β,21-dihydroxy -4-pregnene-3,20-dione; |
| Research Area | An adrenocortical steroid which exerts regulatory influence on metabolism of electrolytes and water. Biologically active aldosterone isomer; a mineralocorticoid produced by the adrenal cortex that induces urinary excretion of K+ and renal reabsorptioon . |
| Molecular Formula | C21H28O5 |
| CAS# | 52-39-1 |
| Purity | >98% |
| SMILES | O=C[C@@]1([C@H]2C(CO)=O)[C@](CC2)([H])[C@@](CCC3=CC4=O)([H])[C@]([C@]3(CC4)C)([H])[C@@H](O)C1 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30494.html |
