Prednisolone acetate 10mM * 1mL in DMSO
Prednisolone is a synthetic glucocorticoid, a derivative of cortisol, which is used to treat a variety of inflammatory and auto-immune conditions.
Trivial name | Prednisolone acetate 10mM * 1mL in DMSO |
Catalog Number | A11687-10mM-D |
Alternative Name(s) | 11b,17,21-Trihydroxypregna-1,4-diene-3,20-dione 21-acetate |
Molecular Formula | C23H30O6 |
CAS# | 52-21-1 |
SMILES | CC(=O)OCC(=O)[C@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)C=C[C@]34C)O)C)O |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/prednisolone-acetate-omnipred.html |