Prednisolone acetate 10mM * 1mL in DMSO
Prednisolone is a synthetic glucocorticoid, a derivative of cortisol, which is used to treat a variety of inflammatory and auto-immune conditions.
| Trivial name | Prednisolone acetate 10mM * 1mL in DMSO |
| Catalog Number | A11687-10mM-D |
| Alternative Name(s) | 11b,17,21-Trihydroxypregna-1,4-diene-3,20-dione 21-acetate |
| Molecular Formula | C23H30O6 |
| CAS# | 52-21-1 |
| SMILES | CC(=O)OCC(=O)[C@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)C=C[C@]34C)O)C)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/prednisolone-acetate-omnipred.html |
