Spironolactone D3
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-00897 |
| Alternative Name(s) | (1'S,2R,2'R,9'R,10'R,11'S,15'S)‐9'‐ (7α,7α)-7-(cetylthyo-d3)-17hydroxy-3-oxopregn-4-one-21carboxylc cid γ-Lctone; 7α-cetylthio-d3-3-oxo-17α-pregn-4-ene-21,17carbolctone; c-9420; Adctone; S-((2’R,7R,8R,9S,10R,13S,14S)-10,13-Dimethyl-3,5’-dioxo-1,2,3,4’,5’,6,7,8,9,10,11,12,13,14,15,16-hexadcahydro-3’H-spirocclopenta[a]phenanthrene-17,2’-furan]-7-yl) ethanethioate-d3 8208; |
| Research Area | Labeled Spironolactone, intended for use as an internal standard for the quantification of Spironolactone by GC- or LC-mass spectrometry. |
| Molecular Formula | C24H29D3O4S |
| CAS# | 52-01-7 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@@]12[C@](OC3=O)(CC3([2H])[2H])CC[C@@]1([H])[C@@]([C@](CC4=C([2H])C5=O)([2H])SC(C)=O)([H])[C@]([C@]4(CC5([2H])[2H])C)([H])CC2 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00897.html |
| Additional Information | NULL |