Pipemidic acid
Pipemidic acid (Acido pipemidico) is a pyridopyrimidine antibiotic derivative of piromidic acid with activity against gram-negative bacteria including Pseudomonas aeruginosa and some gram-positive bacteria. Pipemidic acid is an inhibitor of DNA gyrase that is a bacterial enzyme which catalyzes the ATP-dependent negative supercoiling of DNA. It can be used for the research of intestinal, urinary, and biliary tract infections.
| Trivial name | Acido pipemidico |
| Catalog Number | S5051 |
| Molecular Formula | C20H14NO4 |
| CAS# | 51940-44-4 |
| Inchi | InChI=1S/C20H14NO4/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21/h2-8H,9-10H2,1H3/q+1 |
| Inchi Key | INVGWHRKADIJHF-UHFFFAOYSA-N |
| SMILES | C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/pipemidic-acid.html |
| Additional Information | https://file.selleck.cn/downloads/struct/pipemidic-acid-chemical-structure-s5051.gif |