LY573636 10mM * 1mL in DMSO
LY573636 is a potent anti-tumor agent, which causes growth arrest and apoptosis of a variety of human solid tumors in vitro and in vivo. LY573636-induced apoptosis occurs by a mitochondrial-targeted mechanism.
| Trivial name | LY573636 10mM * 1mL in DMSO |
| Catalog Number | A13070-10mM-D |
| Alternative Name(s) | Benzamide, N-[(5-bromo-2-thienyl)sulfonyl]-2,4-dichloro |
| Molecular Formula | C11H6BrCl2NO3S2 |
| CAS# | 519055-62-0 |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)NS(=O)(=O)C2=CC=C(S2)Br |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/ly573636-tasisulam.html |