Etofylline
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-11645 |
| Alternative Name(s) | 7-(2-hydroxyethyl)-1,3-dimethyl-1H-purine-2,6(3H,7H)-dione |
| Research Area | An inhibitor of 3',5'-Cyclic Nucleotide Phosphodiesterase. Therapeutically, this compound has diuretic, muscle relaxant, bronchial dilation and CNS stimulant activities. |
| Molecular Formula | C9H12N4O3 |
| CAS# | 519-37-9 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OCCN1C(C(N(C)C2=O)=O)=C(N2C)N=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11645.html |
| Additional Information | NULL |