Pizotifen Malate
Pizotifen Malate is a benzocycloheptene-based drug used to reduce the frequency of recurrent migraine headacheswith, with high affinity for 5-HT and dopamine receptors (Kis = 7.94 and 2.4 nM for 5-HT2C and D2, respectively).
| Trivial name | BC-105 |
| Catalog Number | CSN10104 |
| Alternative Name(s) | BC-105 |
| Research Area | Neurological Disease |
| Molecular Formula | C23H27NO5S |
| CAS# | 5189-11-7 |
| Purity | ≥99% |
| SMILES | O=C(O)C(O)CC(O)=O.CN1CC/C(CC1)=C2C3=CC=CC=C3CCC4=C\2C=CS4 |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/pizotifen-malate.html |