Emodin
Emodin shows antiproliferative effects in cancer cells that are regulated by different signaling pathways, it is a naturally occurring anthraquinone present in the roots and barks of numerous plants.
| Trivial name | Emodol |
| Catalog Number | CSN18468 |
| Alternative Name(s) | Emodol |
| Research Area | Cancer |
| Molecular Formula | C15H10O5 |
| CAS# | 518-82-1 |
| Purity | ≥99% |
| SMILES | O=C1C2=C(C=C(C)C=C2O)C(C3=CC(O)=CC(O)=C13)=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/emodin.html |