Tetrandrine 200mg
Tetrandrine is a calcium channel blocker. It inhibits the degranulation of mast cells.Tetrandrine has anti-inflammatory and anti-fibrogenic actions, which make tetrandrine and related compounds potentially useful in the treatment of lung silicosis, liver cirrhosis, and rheumatoid arthritis.
| Trivial name | Tetrandrine 200mg |
| Catalog Number | A10921-200 |
| Alternative Name(s) | 6,6',7,12-tetramethoxy-2,2'-dimethyl-1 beta-berbaman |
| Molecular Formula | C38H42N2O6 |
| CAS# | 518-34-3 |
| SMILES | CN1CCC2=CC(=C3C=C2[C@@H]1CC4=CC=C(C=C4)OC5=C(C=CC(=C5)C[C@H]6C7=C(O3)C(=C(C=C7CCN6C)OC)OC)OC)OC |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/tetrandrine-fanchinine.html |