(+)-Menthyl acetate | MedChemExpress (MCE)
(+)-Menthyl acetate is a compound isolated from natural Cunila angustifolia Benth essential oil. The selectivity of (+)-Menthyl acetate is higher than that of MCF-7 cell line, IC50=34.0 μg?mL-1, and lower than that of SK-Mel-28 cell line, IC50=279.9 μg?mL-1, on A549 cell without fatal [1].
| Trivial name | (+)-Menthyl acetate |
| Catalog Number | HY-W317408 |
| Research Area | Others |
| CAS# | 5157-89-1 |
| Purity | ≥98.00% |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1OC(=O)C |
| PubChem Chemical Structure ID | 62335 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/plus-menthyl-acetate.html |