β-Patchoulene | MedChemExpress (MCE)
β-Patchoulene is a tricyclic sesquiterpene isolated from the oil of Pogostemon cablin (patchouli oil). β-Patchoulene
can be used for the treatment of inflammatory diseases[1].
| Trivial name | β-Patchoulene |
| Catalog Number | HY-N12378 |
| Research Area | Inflammation/Immunology |
| CAS# | 514-51-2 |
| Purity | ≥98.00% |
| SMILES | C[C@]1(CC2)C(CC[C@@H]3C)=C3C[C@]2([H])C(C)1C |
| PubChem Chemical Structure ID | 12313993 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/β-patchoulene.html |