Tizanidine
API Standard
| Catalog Number | CS-O-02459 |
| Alternative Name(s) | 5chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-2,1,3- benzothiadiazol-4-amine |
| Research Area | Tizanidine is a short-acting drug for the management of spasticity. Tizanidine is an agonist at a2-adrenergic receptor sites and presumably reduces spasticity by increasing presynaptic inhibition of motor neurons. In animal models, tizanidine has no direc |
| Molecular Formula | C9HClN5S |
| CAS# | 51322-75-9 |
| Purity | >98% |
| SMILES | ClC1=C(C2=NSN=C2C=C1)NC3=NCCN3 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02459.html |