L-NAME HCl
L-NAME HCl (NG-Nitroarginine methyl ester, N-Nitro-L-arginine methylester) is a nonselective inhibitor of nitric oxide synthetases (NOS) for nNOS (bovine), eNOS (human), and iNOS (murine), with Ki of 15 nM, 39 nM and 4.4 μM, respectively. L-NAME HCl can be used to induce animal models of Hypertension.
| Trivial name | NG-Nitroarginine methyl ester, N-Nitro-L-arginine methylester |
| Catalog Number | S2877 |
| Molecular Formula | C15H10FN3O3 |
| CAS# | 51298-62-5 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | OC1=CC=C(C=C1)C(=O)N\N=C2/C(=O)NC3=C2C=C(F)C=C3 |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/l-name-hcl.html |
| Additional Information | https://file.selleck.cn/downloads/struct/L-NAME-HCl-chemical-structure-s2877.jpg |
