4′,7-Dimethoxy-5-Hydroxyflavone
Apigenin 7,4′-dimethyl ether is a dimethoxyflavone that is the 7,4′-dimethyl ether derivative of apigenin. It has a role as a plant metabolite. It is a dimethoxyflavone and a monohydroxyflavone. It is functionally related to an apigenin.
| Catalog Number | PIPE-0649 |
| Alternative Name(s) | 7,4'-Di-O-methylapigenin Apigenin 7,4'-dimethyl ether Apigenin dimethylether Genkwanin 4'-methyl ether |
| Research Area | Natural Extract |
| Molecular Formula | C17H14O5 |
| CAS# | 5128-44-9 |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(C=C(C=C3O2)OC)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/47-dimethoxy-5-hydroxyflavone-item-9588.html |