Diosgenin 50mg
Diosgenin is a steroid sapogenin and the precursor for the semisynthesis of progesterone which in turn was used in early combined oral contraceptive pills.It is the product of hydrolysis by acids, strong bases, or enzymes of saponins, extracted from the tubers of Dioscorea wild yam, such as the Kokoro.
| Trivial name | Diosgenin 50mg |
| Catalog Number | A10315-50 |
| Alternative Name(s) | (3??,25R)-spirost-5-en-3-ol |
| Molecular Formula | C27H42O3 |
| CAS# | 512-04-9 |
| SMILES | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC=C6C5(CCC(C6)O)C)C)C)OC1 |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/diosgenin.html |
