8-Bromo-cGMP sodium
8-Bromo-cGMP sodium, a membrane-permeable analogue of cGMP, is a PKG (protein kinase G) activator. 8-Bromo-cGMP sodium significantly inhibits Ca2+ macroscopic currents and impairs insulin release stimulated with high K+. 8-Bromo-cGMP sodium has antinociceptive effects and results in vasodilator responses.
| Catalog Number | E7649 |
| Molecular Formula | C12H21N.HCl |
| CAS# | 51116-01-9 |
| Inchi | InChI=1S/C12H21N.ClH/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;/h9H,3-8,13H2,1-2H3;1H |
| Inchi Key | LDDHMLJTFXJGPI-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)N)C.Cl |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/8-bromo-cgmp-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7649-8-bromo-cgmp-sodium-chemical-structure-tube.png |