JFD01307SC
JFD01307SC ([(1,1-dioxidotetrahydrothien-3-yl)amino]acetic acid) shows activity against M.tuberculosis with minimum inhibitory concentrations (MICs) in the range of 8 to 16 µg/ml. JFD01307SC may targets enzymes involved in glutamine biosynthesis.
| Trivial name | [(1,1-dioxidotetrahydrothien-3-yl)amino]acetic acid |
| Catalog Number | S6090 |
| Molecular Formula | C6H11NO4S |
| CAS# | 51070-56-5 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | OC(=O)CNC1CC[S](=O)(=O)C1 |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/jfd01307sc.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s6090-jfd01307sc-chemical-structure.gif |