Flurbiprofen
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-01530 |
| Alternative Name(s) | 2-(2-fluoro-[1,1'-biphenyl]-4-yl)propanoic acid |
| Research Area | A potent inhibitor of Cox-1 and Cox-2. |
| Molecular Formula | C15H13FO2 |
| CAS# | 5104-49-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | FC1=C(C2=CC=CC=C2)C=CC(C(C)C(O)=O)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01530.html |
| Additional Information | NULL |