Galanthaminone
Galantamine is a competitive and reversible cholinesterase (AChE) inhibitor and is used for the treatment of mild to moderate Alzheimer’s disease and various other memory impairments.
| Trivial name | Narwedin |
| Catalog Number | CSN12443 |
| Alternative Name(s) | Narwedin |
| Research Area | Neurological Disease |
| Molecular Formula | C17H19NO3 |
| CAS# | 510-77-0 |
| Purity | ≥99% |
| SMILES | O=C1C=C[C@@]23CCN(C)CC4=CC=C(OC)C(O[C@@]3([H])C1)=C24 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/galanthaminone.html |