Atropine
API Standard
| Catalog Number | CS-O-03855 |
| Alternative Name(s) | Hyocyamine; Atropen |
| Research Area | ATROPINE is an alkaloid, originally from Atropa belladonna, but found in other plants, mainly SOLANACEAE. Hyoscyamine is the 3(S)-endo isomer of atropine. Hyoscyamine is used to provide symptomatic relief to various gastrointestinal disorders including sp |
| Molecular Formula | C17H23NO3 |
| CAS# | 51-55-8 |
| Purity | >98% |
| SMILES | O=C(C(C1=CC=CC=C1)CO)O[C@H]2C[C@@H](CC3)N(C)[C@@H]3C2 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03855.html |