L-Thyroxine 25mg
Levothyroxine, also L-thyroxine or T4, is a synthetic form of the thyroid hormone thyroxine, which is normally secreted by the follicular cells of the thyroid gland.
| Trivial name | L-Thyroxine 25mg |
| Catalog Number | A11669-25 |
| Alternative Name(s) | N/A |
| Molecular Formula | C15H11I4NO4 |
| CAS# | 51-48-9 |
| SMILES | C1=C(C=C(C(=C1I)OC2=CC(=C(C(=C2)I)O)I)I)C[C@@H](C(=O)O)N |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/l-thyroxine.html |
