Norepinephrine (Standard) | MedChemExpress (MCE)
Norepinephrine (Standard) is the analytical standard of Norepinephrine. This product is intended for research and analytical applications. Norepinephrine (Levarterenol; L-Noradrenaline) is a potent adrenergic receptor (AR) agonist. Norepinephrine activates α1, α2, β1 receptors[1][2][3][4].
| Trivial name | Norepinephrine (Standard) |
| Catalog Number | HY-13715R |
| Alternative Name(s) | Levarterenol (Standard); L-Noradrenaline (Standard) |
| Research Area | Endocrinology; Cardiovascular Disease; Cancer |
| CAS# | 51-41-2 |
| Purity | ≥98.0% |
| SMILES | OC1=CC=C([C@@H](O)CN)C=C1O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/norepinephrine-standard.html |