3,5-Dichlorobenzoic acid | MedChemExpress (MCE)
3,5-Dichlorobenzoic acid (3,5-Dichlorobenzoic) is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1].

Trivial name | 3,5-Dichlorobenzoic acid |
Catalog Number | HY-Y0601 |
Alternative Name(s) | 3,5-Dichlorobenzoic; 3,5-Dichlorobenzoic acid |
Research Area | Others |
CAS# | 51-36-5 |
Purity | ≥98.0% |
SMILES | O=C(O)C1=CC(Cl)=CC(Cl)=C1 |
Size | 100 g |
Supplier Page | https://www.medchemexpress.com/3-5-dichlorobenzoic-acid.html |