Fluorometholone is a corticosteroid (ophthalmic).
| Catalog Number | API0232520 |
| Alternative Name(s) | 5-Fluorouracil; fluorouracil; 5-FU |
| Research Area | API |
| Molecular Formula | C4H3FN2O2 |
| CAS# | 51-21-8 |
| Inchi | InChI=1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9) |
| Inchi Key | GHASVSINZRGABV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1)F |
| Size | inquiry |
| Supplier Page | https://apihub.protheragen.ai/fluorouracil-item-1020.html |
A pyrimidine analog that is an antineoplastic antimetabolite. It interferes with DNA synthesis by blocking the thymidylate synthetase conversion of deoxyuridylic acid to thymidylic acid.
| Catalog Number | API51218 |
| Alternative Name(s) | fluorouracil 5-FU Fluoroplex |
| Research Area | Anti-Tumor APIs |
| Molecular Formula | C4H3FN2O2 |
| CAS# | 51-21-8 |
| SMILES | C1=C(C(=O)NC(=O)N1)F |
| Size | inquiry |
| Supplier Page | https://www.protheragen.ai/fluorouracil-item-5898.html |
