Procaine Hydrochloride
API Standard
| Catalog Number | CS-O-11721 |
| Alternative Name(s) | 2-(diethylamino)ethyl 4-aminobenzoate hydrochloride |
| Research Area | Procaine is a local anesthetic of the amino ester group that is primarily used as a topical anesthetic. Procaine is also used to control the pain of intramuscular injection of penicillin as well as in dentistry. |
| Molecular Formula | C13H21ClN2O2 |
| CAS# | 51-05-8 |
| Purity | >98% |
| SMILES | O=C(C1=CC=C(N)C=C1)OCCN(CC)CC.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11721.html |