Piperonyl butoxide
Piperonyl butoxide (PBO, Butacide, Ethanol butoxide, Pyrenone 606,ENT-14250) is a man-made pesticide synergist, working with insect killers to increase their effectiveness.Piperonyl butoxide is an inhibitor of cytochrome P450 monooxygenases(P450s).
| Trivial name | Butacide, Ethanol butoxide, Pyrenone 606,ENT-14250 |
| Catalog Number | S4831 |
| Molecular Formula | C24H30N8O |
| CAS# | 51-03-6 |
| SMILES | CCOC1=C(C=CC(=C1)C2=NN=CN2C)NC3=NC=C4C=C(N=C(C4=N3)NCC(C)(C)C)C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/piperonyl-butoxide.html |
| Additional Information | https://file.selleck.cn/downloads/struct/piperonyl-butoxide-chemical-structure-S4831.gif |