Mizoribine
DNA/RNA synthesis inhibitor Others|IMPDH
| Catalog Number | B1472-25 |
| Research Area | Others|IMPDH |
| Molecular Formula | C9H13N3O6 |
| CAS# | 50924-49-7 |
| Purity | 99.92% |
| SMILES | C1=NC(=C(N1C2C(C(C(O2)CO)O)O)O)C(=O)N |
| Size | 25mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B1472 |
